C18H20N2O5S — CID 133363308
2,2-dimethyl-N-(4-methylsulfonyl-2-nitrophenyl)-3,4-dihydrochromen-4-amine (PubChem CID 133363308) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methylsulfonyl-2-nitrophenyl)-3,4-dihydrochromen-4-amine.
| Compound Name | 2,2-dimethyl-N-(4-methylsulfonyl-2-nitrophenyl)-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 133363308 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2,2-dimethyl-N-(4-methylsulfonyl-2-nitrophenyl)-3,4-dihydrochromen-4-amine |
| SMILES | CC1(C)CC(Nc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])c2ccccc2O1 |
| InChI | InChI=1S/C18H20N2O5S/c1-18(2)11-15(13-6-4-5-7-17(13)25-18)19-14-9-8-12(26(3,23)24)10-16(14)20(21)22/h4-10,15,19H,11H2,1-3H3 |
| InChIKey | QCWKCCLXIDLYFT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|