C22H23N5O4 — CID 112820329
N-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl)-5-nitro-1H-indazole-3-carboxamide (PubChem CID 112820329) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl)-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl)-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 112820329 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl)-5-nitro-1H-indazole-3-carboxamide |
| SMILES | CN1CCC2(CC1)CC(NC(=O)c1n[nH]c3ccc([N+](=O)[O-])cc13)c1ccccc1O2 |
| InChI | InChI=1S/C22H23N5O4/c1-26-10-8-22(9-11-26)13-18(15-4-2-3-5-19(15)31-22)23-21(28)20-16-12-14(27(29)30)6-7-17(16)24-25-20/h2-7,12,18H,8-11,13H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | AYPUOKMNIUUFAK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|