C17H15NO6 — CID 9013412
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-nitrophenoxy)ethanone (PubChem CID 9013412) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-nitrophenoxy)ethanone.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 9013412 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-nitrophenoxy)ethanone |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H15NO6/c19-14(11-24-15-5-2-1-4-13(15)18(20)21)12-6-7-16-17(10-12)23-9-3-8-22-16/h1-2,4-7,10H,3,8-9,11H2 |
| InChIKey | QFANADAIGOXYJA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|