C16H14N2O6 — CID 8649040
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-nitro-3-pyridinyl)oxy]ethanone (PubChem CID 8649040) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-nitro-3-pyridinyl)oxy]ethanone.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-nitro-3-pyridinyl)oxy]ethanone |
|---|---|
| PubChem CID | 8649040 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-nitro-3-pyridinyl)oxy]ethanone |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C16H14N2O6/c19-12(10-24-14-3-1-6-17-16(14)18(20)21)11-4-5-13-15(9-11)23-8-2-7-22-13/h1,3-6,9H,2,7-8,10H2 |
| InChIKey | PWOTUIMKBRKTHX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|