C16H20N4O5 — CID 171717156
tert-butyl N-[2-[(3S)-7-isocyano-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl]ethyl]carbamate (PubChem CID 171717156) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(3S)-7-isocyano-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3S)-7-isocyano-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 171717156 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | tert-butyl N-[2-[(3S)-7-isocyano-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl]ethyl]carbamate |
| SMILES | [C-]#[N+]c1cc2c(c([N+](=O)[O-])c1)N[C@@H](CCNC(=O)OC(C)(C)C)CO2 |
| InChI | InChI=1S/C16H20N4O5/c1-16(2,3)25-15(21)18-6-5-10-9-24-13-8-11(17-4)7-12(20(22)23)14(13)19-10/h7-8,10,19H,5-6,9H2,1-3H3,(H,18,21)/t10-/m0/s1 |
| InChIKey | NUHZGZAHKIMVJI-JTQLQIEISA-N |
| XLogP | 3.23 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|