C10H21N5O2 — CID 18432440
tert-butyl N-[2-(2-hydrazinyl-4,5-dihydro-1H-imidazol-5-yl)ethyl]carbamate (PubChem CID 18432440) has the molecular formula C10H21N5O2 and a molecular weight of 243.31 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydrazinyl-4,5-dihydro-1H-imidazol-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-hydrazinyl-4,5-dihydro-1H-imidazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 18432440 |
| Molecular Formula | C10H21N5O2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | tert-butyl N-[2-(2-hydrazinyl-4,5-dihydro-1H-imidazol-5-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1CN=C(NN)N1 |
| InChI | InChI=1S/C10H21N5O2/c1-10(2,3)17-9(16)12-5-4-7-6-13-8(14-7)15-11/h7H,4-6,11H2,1-3H3,(H,12,16)(H2,13,14,15) |
| InChIKey | LSIXUPSUKOCORH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|