C17H21N5O3 — CID 171717192
tert-butyl N-[2-[(11S)-2-amino-6-isocyano-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]ethyl]carbamate (PubChem CID 171717192) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(11S)-2-amino-6-isocyano-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(11S)-2-amino-6-isocyano-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 171717192 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | tert-butyl N-[2-[(11S)-2-amino-6-isocyano-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]ethyl]carbamate |
| SMILES | [C-]#[N+]c1cc2c3c(c1)nc(N)n3[C@@H](CCNC(=O)OC(C)(C)C)CO2 |
| InChI | InChI=1S/C17H21N5O3/c1-17(2,3)25-16(23)20-6-5-11-9-24-13-8-10(19-4)7-12-14(13)22(11)15(18)21-12/h7-8,11H,5-6,9H2,1-3H3,(H2,18,21)(H,20,23)/t11-/m0/s1 |
| InChIKey | OIHIQLITYXGNLV-NSHDSACASA-N |
| XLogP | 3.02 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|