C19H23N5O4 — CID 146349909
tert-butyl N-[(E)-4-(2-amino-5-carbamoylfuro[3,2-g]benzimidazol-1-yl)but-2-enyl]carbamate (PubChem CID 146349909) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-(2-amino-5-carbamoylfuro[3,2-g]benzimidazol-1-yl)but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-(2-amino-5-carbamoylfuro[3,2-g]benzimidazol-1-yl)but-2-enyl]carbamate |
|---|---|
| PubChem CID | 146349909 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl N-[(E)-4-(2-amino-5-carbamoylfuro[3,2-g]benzimidazol-1-yl)but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/Cn1c(N)nc2cc(C(N)=O)c3ccoc3c21 |
| InChI | InChI=1S/C19H23N5O4/c1-19(2,3)28-18(26)22-7-4-5-8-24-14-13(23-17(24)21)10-12(16(20)25)11-6-9-27-15(11)14/h4-6,9-10H,7-8H2,1-3H3,(H2,20,25)(H2,21,23)(H,22,26)/b5-4+ |
| InChIKey | AMCCDKOLFAEWRD-SNAWJCMRSA-N |
| XLogP | 2.54 |
| TPSA | 138.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|