C17H24FN3O4 — CID 175344554
tert-butyl N-[4-(4-carbamoyl-5-fluoro-2-methoxyanilino)but-2-enyl]carbamate (PubChem CID 175344554) has the molecular formula C17H24FN3O4 and a molecular weight of 353.39 g/mol. Its IUPAC name is tert-butyl N-[4-(4-carbamoyl-5-fluoro-2-methoxyanilino)but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-carbamoyl-5-fluoro-2-methoxyanilino)but-2-enyl]carbamate |
|---|---|
| PubChem CID | 175344554 |
| Molecular Formula | C17H24FN3O4 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | tert-butyl N-[4-(4-carbamoyl-5-fluoro-2-methoxyanilino)but-2-enyl]carbamate |
| SMILES | COc1cc(C(N)=O)c(F)cc1NCC=CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24FN3O4/c1-17(2,3)25-16(23)21-8-6-5-7-20-13-10-12(18)11(15(19)22)9-14(13)24-4/h5-6,9-10,20H,7-8H2,1-4H3,(H2,19,22)(H,21,23) |
| InChIKey | LWQSDBOSUNAWPO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|