C9H8ClN2O3+ — CID 89378856
(7-chloro-3-oxo-4H-1,4-benzoxazin-5-yl)-methyl-oxoazanium (PubChem CID 89378856) has the molecular formula C9H8ClN2O3+ and a molecular weight of 227.63 g/mol. Its IUPAC name is (7-chloro-3-oxo-4H-1,4-benzoxazin-5-yl)-methyl-oxoazanium.
| Compound Name | (7-chloro-3-oxo-4H-1,4-benzoxazin-5-yl)-methyl-oxoazanium |
|---|---|
| PubChem CID | 89378856 |
| Molecular Formula | C9H8ClN2O3+ |
| Molecular Weight | 227.63 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | (7-chloro-3-oxo-4H-1,4-benzoxazin-5-yl)-methyl-oxoazanium |
| SMILES | C[N+](=O)c1cc(Cl)cc2c1NC(=O)CO2 |
| InChI | InChI=1S/C9H7ClN2O3/c1-12(14)6-2-5(10)3-7-9(6)11-8(13)4-15-7/h2-3H,4H2,1H3/p+1 |
| InChIKey | VXIIMANXDOVIEF-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|