C10H12N2O2 — CID 82229995
6-amino-5,8-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 82229995) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-amino-5,8-dimethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-5,8-dimethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82229995 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 6-amino-5,8-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc(N)c(C)c2c1OCC(=O)N2 |
| InChI | InChI=1S/C10H12N2O2/c1-5-3-7(11)6(2)9-10(5)14-4-8(13)12-9/h3H,4,11H2,1-2H3,(H,12,13) |
| InChIKey | DUTKKMCRLLKGIE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|