C8H7BrN2O2 — CID 82231984
6-amino-8-bromo-4H-1,4-benzoxazin-3-one (PubChem CID 82231984) has the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. Its IUPAC name is 6-amino-8-bromo-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-8-bromo-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82231984 |
| Molecular Formula | C8H7BrN2O2 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 6-amino-8-bromo-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc(Br)c2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C8H7BrN2O2/c9-5-1-4(10)2-6-8(5)13-3-7(12)11-6/h1-2H,3,10H2,(H,11,12) |
| InChIKey | OGQOJMAQFUVNCR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|