C9H8BrNO3 — CID 170334761
7-bromo-8-methoxy-4H-1,4-benzoxazin-3-one (PubChem CID 170334761) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is 7-bromo-8-methoxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-bromo-8-methoxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170334761 |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 7-bromo-8-methoxy-4H-1,4-benzoxazin-3-one |
| SMILES | COc1c(Br)ccc2c1OCC(=O)N2 |
| InChI | InChI=1S/C9H8BrNO3/c1-13-8-5(10)2-3-6-9(8)14-4-7(12)11-6/h2-3H,4H2,1H3,(H,11,12) |
| InChIKey | WHPHFTILIMBLTI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |