C14H10BrNO3 — CID 118093821
6-bromo-5-phenoxy-4H-1,4-benzoxazin-3-one (PubChem CID 118093821) has the molecular formula C14H10BrNO3 and a molecular weight of 320.14 g/mol. Its IUPAC name is 6-bromo-5-phenoxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-5-phenoxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 118093821 |
| Molecular Formula | C14H10BrNO3 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 6-bromo-5-phenoxy-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(Br)c(Oc3ccccc3)c2N1 |
| InChI | InChI=1S/C14H10BrNO3/c15-10-6-7-11-13(16-12(17)8-18-11)14(10)19-9-4-2-1-3-5-9/h1-7H,8H2,(H,16,17) |
| InChIKey | GJFGOWQHTQZQTB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |