C10H9NO4 — CID 59153381
methyl 3-oxo-4H-1,4-benzoxazine-5-carboxylate (PubChem CID 59153381) has the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. Its IUPAC name is methyl 3-oxo-4H-1,4-benzoxazine-5-carboxylate.
| Compound Name | methyl 3-oxo-4H-1,4-benzoxazine-5-carboxylate |
|---|---|
| PubChem CID | 59153381 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | methyl 3-oxo-4H-1,4-benzoxazine-5-carboxylate |
| SMILES | COC(=O)c1cccc2c1NC(=O)CO2 |
| InChI | InChI=1S/C10H9NO4/c1-14-10(13)6-3-2-4-7-9(6)11-8(12)5-15-7/h2-4H,5H2,1H3,(H,11,12) |
| InChIKey | GICYBPVXQLNXKH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |