methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate

C11H13NO3 — CID 115098661

IUPACmethyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate
SMILESCOC(=O)c1cccc2c1NCCCO2
InChIInChI=1S/C11H13NO3/c1-14-11(13)8-4-2-5-9-10(8)12-6-3-7-15-9/h2,4-5,12H,3,6-7H2,1H3
InChIKeyKXBYDXAZMXAHFL-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.67
Rot. Bonds1

About methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate

methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate (PubChem CID 115098661) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate.

Molecular Properties

Compound Namemethyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate
PubChem CID115098661
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Namemethyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate
SMILESCOC(=O)c1cccc2c1NCCCO2
InChIInChI=1S/C11H13NO3/c1-14-11(13)8-4-2-5-9-10(8)12-6-3-7-15-9/h2,4-5,12H,3,6-7H2,1H3
InChIKeyKXBYDXAZMXAHFL-UHFFFAOYSA-N
XLogP1.67
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate?
The IUPAC name of methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate (CID 115098661) is methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate.
What is the SMILES notation for methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate?
The canonical SMILES for methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate is COC(=O)c1cccc2c1NCCCO2.
What is the InChIKey of methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate?
The InChIKey is KXBYDXAZMXAHFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-14-11(13)8-4-2-5-9-10(8)12-6-3-7-15-9/h2,4-5,12H,3,6-7H2,1H3.
What are the key properties of methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate?
methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3,4,5-tetrahydro-1,5-benzoxazepine-6-carboxylate is sourced from PubChem (CID 115098661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).