About Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate
Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate (PubChem CID 130120340) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate.
Analyze Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
The IUPAC name of Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate (CID 130120340) is methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate.
What is the SMILES notation for Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
The canonical SMILES for Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate is COC(=O)C1=CC=CC2=C1OCCNC2.
What is the InChIKey of Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
The InChIKey is CMPNPCNKZIUTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-14-11(13)9-4-2-3-8-7-12-5-6-15-10(8)9/h2-4,12H,5-7H2,1H3.
What are the key properties of Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate is sourced from PubChem (CID 130120340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).