methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate

C11H13NO3 — CID 130120340

IUPACmethyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate
SMILESCOC(=O)c1cccc2c1OCCNC2
InChIInChI=1S/C11H13NO3/c1-14-11(13)9-4-2-3-8-7-12-5-6-15-10(8)9/h2-4,12H,5-7H2,1H3
InChIKeyCMPNPCNKZIUTDA-UHFFFAOYSA-N
MW207.23 g/mol
LogP0.96
Rot. Bonds1

About methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate

methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate (PubChem CID 130120340) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate.

Molecular Properties

Compound Namemethyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate
PubChem CID130120340
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Namemethyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate
SMILESCOC(=O)c1cccc2c1OCCNC2
InChIInChI=1S/C11H13NO3/c1-14-11(13)9-4-2-3-8-7-12-5-6-15-10(8)9/h2-4,12H,5-7H2,1H3
InChIKeyCMPNPCNKZIUTDA-UHFFFAOYSA-N
XLogP0.96
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
The IUPAC name of methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate (CID 130120340) is methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate.
What is the SMILES notation for methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
The canonical SMILES for methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate is COC(=O)c1cccc2c1OCCNC2.
What is the InChIKey of methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
The InChIKey is CMPNPCNKZIUTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-14-11(13)9-4-2-3-8-7-12-5-6-15-10(8)9/h2-4,12H,5-7H2,1H3.
What are the key properties of methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate?
methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylate is sourced from PubChem (CID 130120340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).