C10H10N2O3 — CID 115095927
methyl 3-oxo-2,4-dihydro-1H-quinoxaline-5-carboxylate (PubChem CID 115095927) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl 3-oxo-2,4-dihydro-1H-quinoxaline-5-carboxylate.
| Compound Name | methyl 3-oxo-2,4-dihydro-1H-quinoxaline-5-carboxylate |
|---|---|
| PubChem CID | 115095927 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | methyl 3-oxo-2,4-dihydro-1H-quinoxaline-5-carboxylate |
| SMILES | COC(=O)c1cccc2c1NC(=O)CN2 |
| InChI | InChI=1S/C10H10N2O3/c1-15-10(14)6-3-2-4-7-9(6)12-8(13)5-11-7/h2-4,11H,5H2,1H3,(H,12,13) |
| InChIKey | PETHEYLHVZZUKS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |