About methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate
methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate (PubChem CID 115096573) has the molecular formula C12H13NO3S
and a molecular weight of 251.31 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate.
Analyze methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate?
The IUPAC name of methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate (CID 115096573) is methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate.
What is the SMILES notation for methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate?
The canonical SMILES for methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate is COC(=O)c1cccc2c1NC(=O)C(C)(C)S2.
What is the InChIKey of methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate?
The InChIKey is VDZFDEZHEMLDLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3S/c1-12(2)11(15)13-9-7(10(14)16-3)5-4-6-8(9)17-12/h4-6H,1-3H3,(H,13,15).
What are the key properties of methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate?
methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate has a molecular weight of 251.31 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-oxo-4H-1,4-benzothiazine-5-carboxylate is sourced from PubChem (CID 115096573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).