About methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate
methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate (PubChem CID 68501471) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate.
Analyze methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate?
The IUPAC name of methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate (CID 68501471) is methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate.
What is the SMILES notation for methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate?
The canonical SMILES for methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate is COC(=O)c1cccc2c1NC(=O)CC2(C)C.
What is the InChIKey of methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate?
The InChIKey is WAQLGKGQKIVSIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-13(2)7-10(15)14-11-8(12(16)17-3)5-4-6-9(11)13/h4-6H,7H2,1-3H3,(H,14,15).
What are the key properties of methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate?
methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,4-dimethyl-2-oxo-1,3-dihydroquinoline-8-carboxylate is sourced from PubChem (CID 68501471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).