C12H13NO5S — CID 115095848
methyl 3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-5-carboxylate (PubChem CID 115095848) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is methyl 3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-5-carboxylate.
| Compound Name | methyl 3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-5-carboxylate |
|---|---|
| PubChem CID | 115095848 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | methyl 3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-5-carboxylate |
| SMILES | COC(=O)c1cccc2c1NC(C)(C)C(=O)S2(=O)=O |
| InChI | InChI=1S/C12H13NO5S/c1-12(2)11(15)19(16,17)8-6-4-5-7(9(8)13-12)10(14)18-3/h4-6,13H,1-3H3 |
| InChIKey | NMRHREHSJBMQOF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|