C14H20N2O2S — CID 153394820
ethane;methyl 2,2-dimethyl-3-sulfanylidene-1,4-dihydroquinoxaline-5-carboxylate (PubChem CID 153394820) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is ethane;methyl 2,2-dimethyl-3-sulfanylidene-1,4-dihydroquinoxaline-5-carboxylate.
| Compound Name | ethane;methyl 2,2-dimethyl-3-sulfanylidene-1,4-dihydroquinoxaline-5-carboxylate |
|---|---|
| PubChem CID | 153394820 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | ethane;methyl 2,2-dimethyl-3-sulfanylidene-1,4-dihydroquinoxaline-5-carboxylate |
| SMILES | CC.COC(=O)c1cccc2c1NC(=S)C(C)(C)N2 |
| InChI | InChI=1S/C12H14N2O2S.C2H6/c1-12(2)11(17)13-9-7(10(15)16-3)5-4-6-8(9)14-12;1-2/h4-6,14H,1-3H3,(H,13,17);1-2H3 |
| InChIKey | VXAXIMQEFHCAAY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|