C12H13NO3S — CID 115095853
methyl 3,3-dimethyl-2-oxo-4H-1,4-benzothiazine-5-carboxylate (PubChem CID 115095853) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is methyl 3,3-dimethyl-2-oxo-4H-1,4-benzothiazine-5-carboxylate.
| Compound Name | methyl 3,3-dimethyl-2-oxo-4H-1,4-benzothiazine-5-carboxylate |
|---|---|
| PubChem CID | 115095853 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | methyl 3,3-dimethyl-2-oxo-4H-1,4-benzothiazine-5-carboxylate |
| SMILES | COC(=O)c1cccc2c1NC(C)(C)C(=O)S2 |
| InChI | InChI=1S/C12H13NO3S/c1-12(2)11(15)17-8-6-4-5-7(9(8)13-12)10(14)16-3/h4-6,13H,1-3H3 |
| InChIKey | RGCLDSWMUVBDBN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|