C22H17NO4S — CID 169083583
dimethyl 2-phenothiazin-10-ylbenzene-1,3-dicarboxylate (PubChem CID 169083583) has the molecular formula C22H17NO4S and a molecular weight of 391.45 g/mol. Its IUPAC name is dimethyl 2-phenothiazin-10-ylbenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 2-phenothiazin-10-ylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 169083583 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | dimethyl 2-phenothiazin-10-ylbenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cccc(C(=O)OC)c1N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C22H17NO4S/c1-26-21(24)14-8-7-9-15(22(25)27-2)20(14)23-16-10-3-5-12-18(16)28-19-13-6-4-11-17(19)23/h3-13H,1-2H3 |
| InChIKey | MEQHSFURTSGJJP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |