C16H16N2O4 — CID 163111426
dimethyl 4a,5,10,10a-tetrahydrophenazine-1,6-dicarboxylate (PubChem CID 163111426) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is dimethyl 4a,5,10,10a-tetrahydrophenazine-1,6-dicarboxylate.
| Compound Name | dimethyl 4a,5,10,10a-tetrahydrophenazine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 163111426 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | dimethyl 4a,5,10,10a-tetrahydrophenazine-1,6-dicarboxylate |
| SMILES | COC(=O)C1=CC=CC2Nc3c(cccc3C(=O)OC)NC12 |
| InChI | InChI=1S/C16H16N2O4/c1-21-15(19)9-5-3-7-11-13(9)17-12-8-4-6-10(14(12)18-11)16(20)22-2/h3-8,11,13,17-18H,1-2H3 |
| InChIKey | NCGXMHGXUXJPHH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |