C10H10FNO2 — CID 117110564
methyl 3-fluoro-2,3-dihydro-1H-indole-4-carboxylate (PubChem CID 117110564) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is methyl 3-fluoro-2,3-dihydro-1H-indole-4-carboxylate.
| Compound Name | methyl 3-fluoro-2,3-dihydro-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 117110564 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | methyl 3-fluoro-2,3-dihydro-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1C(F)CN2 |
| InChI | InChI=1S/C10H10FNO2/c1-14-10(13)6-3-2-4-8-9(6)7(11)5-12-8/h2-4,7,12H,5H2,1H3 |
| InChIKey | MULSUUGZZQLUMR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |