methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate

C12H16N2O2 — CID 115096466

IUPACmethyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate
SMILESCOC(=O)c1cccc2c1N(C)C(C)CN2
InChIInChI=1S/C12H16N2O2/c1-8-7-13-10-6-4-5-9(12(15)16-3)11(10)14(8)2/h4-6,8,13H,7H2,1-3H3
InChIKeyJIPZGEQBFJRDGT-UHFFFAOYSA-N
MW220.27 g/mol
LogP1.72
Rot. Bonds1

About methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate

methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate (PubChem CID 115096466) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate.

Molecular Properties

Compound Namemethyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate
PubChem CID115096466
Molecular FormulaC12H16N2O2
Molecular Weight220.27 g/mol
Exact Mass220.12
IUPAC Namemethyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate
SMILESCOC(=O)c1cccc2c1N(C)C(C)CN2
InChIInChI=1S/C12H16N2O2/c1-8-7-13-10-6-4-5-9(12(15)16-3)11(10)14(8)2/h4-6,8,13H,7H2,1-3H3
InChIKeyJIPZGEQBFJRDGT-UHFFFAOYSA-N
XLogP1.72
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.27
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate?
The IUPAC name of methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate (CID 115096466) is methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate.
What is the SMILES notation for methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate?
The canonical SMILES for methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate is COC(=O)c1cccc2c1N(C)C(C)CN2.
What is the InChIKey of methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate?
The InChIKey is JIPZGEQBFJRDGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-8-7-13-10-6-4-5-9(12(15)16-3)11(10)14(8)2/h4-6,8,13H,7H2,1-3H3.
What are the key properties of methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate?
methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate has a molecular weight of 220.27 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4-dimethyl-2,3-dihydro-1H-quinoxaline-5-carboxylate is sourced from PubChem (CID 115096466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).