C10H9NO5S — CID 115095731
methyl 1,1,2-trioxo-3,4-dihydro-1λ6,4-benzothiazine-5-carboxylate (PubChem CID 115095731) has the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. Its IUPAC name is methyl 1,1,2-trioxo-3,4-dihydro-1λ6,4-benzothiazine-5-carboxylate.
| Compound Name | methyl 1,1,2-trioxo-3,4-dihydro-1λ6,4-benzothiazine-5-carboxylate |
|---|---|
| PubChem CID | 115095731 |
| Molecular Formula | C10H9NO5S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | methyl 1,1,2-trioxo-3,4-dihydro-1λ6,4-benzothiazine-5-carboxylate |
| SMILES | COC(=O)c1cccc2c1NCC(=O)S2(=O)=O |
| InChI | InChI=1S/C10H9NO5S/c1-16-10(13)6-3-2-4-7-9(6)11-5-8(12)17(7,14)15/h2-4,11H,5H2,1H3 |
| InChIKey | PQZFRVLWXQRQOO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|