About N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide
N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide (PubChem CID 110699638) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide |
| PubChem CID | 110699638 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide |
| SMILES | O=C1COc2cccc(C(=O)NC3CCCCC3)c2N1 |
| InChI | InChI=1S/C15H18N2O3/c18-13-9-20-12-8-4-7-11(14(12)17-13)15(19)16-10-5-2-1-3-6-10/h4,7-8,10H,1-3,5-6,9H2,(H,16,19)(H,17,18) |
| InChIKey | PVFDEDFFIFEINE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide?
The IUPAC name of N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide (CID 110699638) is N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide.
What is the SMILES notation for N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide?
The canonical SMILES for N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide is O=C1COc2cccc(C(=O)NC3CCCCC3)c2N1.
What is the InChIKey of N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide?
The InChIKey is PVFDEDFFIFEINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c18-13-9-20-12-8-4-7-11(14(12)17-13)15(19)16-10-5-2-1-3-6-10/h4,7-8,10H,1-3,5-6,9H2,(H,16,19)(H,17,18).
What are the key properties of N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide?
N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide has a molecular weight of 274.32 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3-oxo-4H-1,4-benzoxazine-5-carboxamide is sourced from PubChem (CID 110699638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).