C18H16N2O5 — CID 110699795
ethyl 2-[(3-oxo-4H-1,4-benzoxazine-5-carbonyl)amino]benzoate (PubChem CID 110699795) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethyl 2-[(3-oxo-4H-1,4-benzoxazine-5-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-[(3-oxo-4H-1,4-benzoxazine-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110699795 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethyl 2-[(3-oxo-4H-1,4-benzoxazine-5-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cccc2c1NC(=O)CO2 |
| InChI | InChI=1S/C18H16N2O5/c1-2-24-18(23)11-6-3-4-8-13(11)19-17(22)12-7-5-9-14-16(12)20-15(21)10-25-14/h3-9H,2,10H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | ZUJVDJUCIFGQNL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |