About 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide
5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide (PubChem CID 110742113) has the molecular formula C13H9BrN2O4
and a molecular weight of 337.13 g/mol. Its IUPAC name is 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide |
| PubChem CID | 110742113 |
| Molecular Formula | C13H9BrN2O4 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide |
| SMILES | O=C1COc2cccc(NC(=O)c3ccc(Br)o3)c2N1 |
| InChI | InChI=1S/C13H9BrN2O4/c14-10-5-4-9(20-10)13(18)15-7-2-1-3-8-12(7)16-11(17)6-19-8/h1-5H,6H2,(H,15,18)(H,16,17) |
| InChIKey | QVOCNIJNBXCOFO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide?
The IUPAC name of 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide (CID 110742113) is 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide?
The canonical SMILES for 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide is O=C1COc2cccc(NC(=O)c3ccc(Br)o3)c2N1.
What is the InChIKey of 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide?
The InChIKey is QVOCNIJNBXCOFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2O4/c14-10-5-4-9(20-10)13(18)15-7-2-1-3-8-12(7)16-11(17)6-19-8/h1-5H,6H2,(H,15,18)(H,16,17).
What are the key properties of 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide?
5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide has a molecular weight of 337.13 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3-oxo-4H-1,4-benzoxazin-5-yl)furan-2-carboxamide is sourced from PubChem (CID 110742113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).