C16H16BrN3O3 — CID 55972451
N-[2-[(5-bromofuran-2-carbonyl)amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 55972451) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is N-[2-[(5-bromofuran-2-carbonyl)amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[(5-bromofuran-2-carbonyl)amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 55972451 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[2-[(5-bromofuran-2-carbonyl)amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1NC(=O)N1CCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H16BrN3O3/c17-14-8-7-13(23-14)15(21)18-11-5-1-2-6-12(11)19-16(22)20-9-3-4-10-20/h1-2,5-8H,3-4,9-10H2,(H,18,21)(H,19,22) |
| InChIKey | JDEDMXVNTUCVFC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |