C16H15N3O3 — CID 110747359
1-benzyl-3-(3-oxo-4H-1,4-benzoxazin-5-yl)urea (PubChem CID 110747359) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-benzyl-3-(3-oxo-4H-1,4-benzoxazin-5-yl)urea.
| Compound Name | 1-benzyl-3-(3-oxo-4H-1,4-benzoxazin-5-yl)urea |
|---|---|
| PubChem CID | 110747359 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-benzyl-3-(3-oxo-4H-1,4-benzoxazin-5-yl)urea |
| SMILES | O=C1COc2cccc(NC(=O)NCc3ccccc3)c2N1 |
| InChI | InChI=1S/C16H15N3O3/c20-14-10-22-13-8-4-7-12(15(13)19-14)18-16(21)17-9-11-5-2-1-3-6-11/h1-8H,9-10H2,(H,19,20)(H2,17,18,21) |
| InChIKey | MLCHXFGFOGJHMS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |