About 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide
3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide (PubChem CID 110713199) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide.
Molecular Properties
| Compound Name | 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide |
| PubChem CID | 110713199 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide |
| SMILES | CC(C)(C)CC(=O)Nc1cccc2c1NC(=O)CO2 |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,3)7-11(17)15-9-5-4-6-10-13(9)16-12(18)8-19-10/h4-6H,7-8H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | YUFMVUVECRVUMN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide?
The IUPAC name of 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide (CID 110713199) is 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide.
What is the SMILES notation for 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide?
The canonical SMILES for 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide is CC(C)(C)CC(=O)Nc1cccc2c1NC(=O)CO2.
What is the InChIKey of 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide?
The InChIKey is YUFMVUVECRVUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-14(2,3)7-11(17)15-9-5-4-6-10-13(9)16-12(18)8-19-10/h4-6H,7-8H2,1-3H3,(H,15,17)(H,16,18).
What are the key properties of 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide?
3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide has a molecular weight of 262.31 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-N-(3-oxo-4H-1,4-benzoxazin-5-yl)butanamide is sourced from PubChem (CID 110713199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).