C16H16N2O2 — CID 110874643
1-benzyl-3-(2,3-dihydro-1-benzofuran-7-yl)urea (PubChem CID 110874643) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-benzyl-3-(2,3-dihydro-1-benzofuran-7-yl)urea.
| Compound Name | 1-benzyl-3-(2,3-dihydro-1-benzofuran-7-yl)urea |
|---|---|
| PubChem CID | 110874643 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-benzyl-3-(2,3-dihydro-1-benzofuran-7-yl)urea |
| SMILES | O=C(NCc1ccccc1)Nc1cccc2c1OCC2 |
| InChI | InChI=1S/C16H16N2O2/c19-16(17-11-12-5-2-1-3-6-12)18-14-8-4-7-13-9-10-20-15(13)14/h1-8H,9-11H2,(H2,17,18,19) |
| InChIKey | OVGVMOJKBRGKQN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |