C9H7BrFNO2 — CID 167249450
6-(bromomethyl)-5-fluoro-4H-1,4-benzoxazin-3-one (PubChem CID 167249450) has the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. Its IUPAC name is 6-(bromomethyl)-5-fluoro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(bromomethyl)-5-fluoro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 167249450 |
| Molecular Formula | C9H7BrFNO2 |
| Molecular Weight | 260.06 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 6-(bromomethyl)-5-fluoro-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CBr)c(F)c2N1 |
| InChI | InChI=1S/C9H7BrFNO2/c10-3-5-1-2-6-9(8(5)11)12-7(13)4-14-6/h1-2H,3-4H2,(H,12,13) |
| InChIKey | CHVCFXGJEWVRNX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.06 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|