C9H8ClNO4S — CID 117408994
(3-oxo-4H-1,4-benzoxazin-5-yl)methanesulfonyl chloride (PubChem CID 117408994) has the molecular formula C9H8ClNO4S and a molecular weight of 261.69 g/mol. Its IUPAC name is (3-oxo-4H-1,4-benzoxazin-5-yl)methanesulfonyl chloride.
| Compound Name | (3-oxo-4H-1,4-benzoxazin-5-yl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117408994 |
| Molecular Formula | C9H8ClNO4S |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | (3-oxo-4H-1,4-benzoxazin-5-yl)methanesulfonyl chloride |
| SMILES | O=C1COc2cccc(CS(=O)(=O)Cl)c2N1 |
| InChI | InChI=1S/C9H8ClNO4S/c10-16(13,14)5-6-2-1-3-7-9(6)11-8(12)4-15-7/h1-3H,4-5H2,(H,11,12) |
| InChIKey | WWAPWYHPVFPJOZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |