C13H16N2O2 — CID 96599034
5-(1-aminocyclopentyl)-4H-1,4-benzoxazin-3-one (PubChem CID 96599034) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-(1-aminocyclopentyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 5-(1-aminocyclopentyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 96599034 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-(1-aminocyclopentyl)-4H-1,4-benzoxazin-3-one |
| SMILES | NC1(c2cccc3c2NC(=O)CO3)CCCC1 |
| InChI | InChI=1S/C13H16N2O2/c14-13(6-1-2-7-13)9-4-3-5-10-12(9)15-11(16)8-17-10/h3-5H,1-2,6-8,14H2,(H,15,16) |
| InChIKey | WEDGKEPFHLPFQD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |