C10H10ClNO3S — CID 117403381
(2-oxo-3,4-dihydro-1H-quinolin-8-yl)methanesulfonyl chloride (PubChem CID 117403381) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-8-yl)methanesulfonyl chloride.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-8-yl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117403381 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-8-yl)methanesulfonyl chloride |
| SMILES | O=C1CCc2cccc(CS(=O)(=O)Cl)c2N1 |
| InChI | InChI=1S/C10H10ClNO3S/c11-16(14,15)6-8-3-1-2-7-4-5-9(13)12-10(7)8/h1-3H,4-6H2,(H,12,13) |
| InChIKey | ZHWBDGGQZYMEEL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |