C10H11ClO2S2 — CID 84710914
3,4-dihydro-2H-thiochromen-8-ylmethanesulfonyl chloride (PubChem CID 84710914) has the molecular formula C10H11ClO2S2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromen-8-ylmethanesulfonyl chloride.
| Compound Name | 3,4-dihydro-2H-thiochromen-8-ylmethanesulfonyl chloride |
|---|---|
| PubChem CID | 84710914 |
| Molecular Formula | C10H11ClO2S2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 3,4-dihydro-2H-thiochromen-8-ylmethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1cccc2c1SCCC2 |
| InChI | InChI=1S/C10H11ClO2S2/c11-15(12,13)7-9-4-1-3-8-5-2-6-14-10(8)9/h1,3-4H,2,5-7H2 |
| InChIKey | HTZLCQFKERHYHD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |