C15H21NS — CID 117372199
4-(3,4-dihydro-2H-thiochromen-8-ylmethyl)piperidine (PubChem CID 117372199) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-thiochromen-8-ylmethyl)piperidine.
| Compound Name | 4-(3,4-dihydro-2H-thiochromen-8-ylmethyl)piperidine |
|---|---|
| PubChem CID | 117372199 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-thiochromen-8-ylmethyl)piperidine |
| SMILES | c1cc2c(c(CC3CCNCC3)c1)SCCC2 |
| InChI | InChI=1S/C15H21NS/c1-3-13-5-2-10-17-15(13)14(4-1)11-12-6-8-16-9-7-12/h1,3-4,12,16H,2,5-11H2 |
| InChIKey | SYBKGTVNQJNELP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |