C14H19NS — CID 84796479
3-(3,4-dihydro-2H-thiochromen-5-ylmethyl)pyrrolidine (PubChem CID 84796479) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-thiochromen-5-ylmethyl)pyrrolidine.
| Compound Name | 3-(3,4-dihydro-2H-thiochromen-5-ylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 84796479 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-thiochromen-5-ylmethyl)pyrrolidine |
| SMILES | c1cc(CC2CCNC2)c2c(c1)SCCC2 |
| InChI | InChI=1S/C14H19NS/c1-3-12(9-11-6-7-15-10-11)13-4-2-8-16-14(13)5-1/h1,3,5,11,15H,2,4,6-10H2 |
| InChIKey | OJLCTOWYOAYECS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |