C9H9NO2S — CID 130045345
8-nitro-3,4-dihydro-2H-thiochromene (PubChem CID 130045345) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 8-nitro-3,4-dihydro-2H-thiochromene.
| Compound Name | 8-nitro-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 130045345 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 8-nitro-3,4-dihydro-2H-thiochromene |
| SMILES | O=[N+]([O-])c1cccc2c1SCCC2 |
| InChI | InChI=1S/C9H9NO2S/c11-10(12)8-5-1-3-7-4-2-6-13-9(7)8/h1,3,5H,2,4,6H2 |
| InChIKey | JSWWGJAIKLJLTI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|