C17H18N2O2 — CID 12042843
N-methyl-N-(2-nitrophenyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 12042843) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-methyl-N-(2-nitrophenyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-methyl-N-(2-nitrophenyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 12042843 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-methyl-N-(2-nitrophenyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | CN(c1ccccc1[N+](=O)[O-])c1cccc2c1CCCC2 |
| InChI | InChI=1S/C17H18N2O2/c1-18(16-10-4-5-11-17(16)19(20)21)15-12-6-8-13-7-2-3-9-14(13)15/h4-6,8,10-12H,2-3,7,9H2,1H3 |
| InChIKey | HLSIFUMOYNMQEG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|