C11H11NO3 — CID 22620551
4-nitro-5,7,8,9-tetrahydrobenzo[7]annulen-6-one (PubChem CID 22620551) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 4-nitro-5,7,8,9-tetrahydrobenzo[7]annulen-6-one.
| Compound Name | 4-nitro-5,7,8,9-tetrahydrobenzo[7]annulen-6-one |
|---|---|
| PubChem CID | 22620551 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-nitro-5,7,8,9-tetrahydrobenzo[7]annulen-6-one |
| SMILES | O=C1CCCc2cccc([N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C11H11NO3/c13-9-5-1-3-8-4-2-6-11(12(14)15)10(8)7-9/h2,4,6H,1,3,5,7H2 |
| InChIKey | GRTBHWWLHXICBM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|