C9H11ClN2O2 — CID 71432719
5-nitro-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 71432719) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 5-nitro-1,2,3,4-tetrahydroquinoline;hydrochloride.
| Compound Name | 5-nitro-1,2,3,4-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 71432719 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 5-nitro-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc2c1CCCN2 |
| InChI | InChI=1S/C9H10N2O2.ClH/c12-11(13)9-5-1-4-8-7(9)3-2-6-10-8;/h1,4-5,10H,2-3,6H2;1H |
| InChIKey | CLCSHHJAYRTPJH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|