C8H9N3O2 — CID 67696977
5-nitro-1,2,3,4-tetrahydroquinazoline (PubChem CID 67696977) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 5-nitro-1,2,3,4-tetrahydroquinazoline.
| Compound Name | 5-nitro-1,2,3,4-tetrahydroquinazoline |
|---|---|
| PubChem CID | 67696977 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-nitro-1,2,3,4-tetrahydroquinazoline |
| SMILES | O=[N+]([O-])c1cccc2c1CNCN2 |
| InChI | InChI=1S/C8H9N3O2/c12-11(13)8-3-1-2-7-6(8)4-9-5-10-7/h1-3,9-10H,4-5H2 |
| InChIKey | HCYZSVHBZOHWQR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|