C10H12N2O2 — CID 130704024
(1R)-1-methyl-5-nitro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 130704024) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (1R)-1-methyl-5-nitro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R)-1-methyl-5-nitro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 130704024 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (1R)-1-methyl-5-nitro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C[C@H]1NCCc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O2/c1-7-8-3-2-4-10(12(13)14)9(8)5-6-11-7/h2-4,7,11H,5-6H2,1H3/t7-/m1/s1 |
| InChIKey | NJFVHSWYFNJRRR-SSDOTTSWSA-N |
| XLogP | 1.80 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|