C10H15N3 — CID 84656202
1-methyl-1,2,3,4-tetrahydroisoquinoline-5,6-diamine (PubChem CID 84656202) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-methyl-1,2,3,4-tetrahydroisoquinoline-5,6-diamine.
| Compound Name | 1-methyl-1,2,3,4-tetrahydroisoquinoline-5,6-diamine |
|---|---|
| PubChem CID | 84656202 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-methyl-1,2,3,4-tetrahydroisoquinoline-5,6-diamine |
| SMILES | CC1NCCc2c1ccc(N)c2N |
| InChI | InChI=1S/C10H15N3/c1-6-7-2-3-9(11)10(12)8(7)4-5-13-6/h2-3,6,13H,4-5,11-12H2,1H3 |
| InChIKey | HTFGYGHDTSXTQV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|