C10H13ClN2 — CID 84667322
7-chloro-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 84667322) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 7-chloro-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | 7-chloro-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 84667322 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 7-chloro-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | CC1NCCc2cc(N)c(Cl)cc21 |
| InChI | InChI=1S/C10H13ClN2/c1-6-8-5-9(11)10(12)4-7(8)2-3-13-6/h4-6,13H,2-3,12H2,1H3 |
| InChIKey | MOFIRTMSQDULEW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|